About [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane
[(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane (PubChem CID 159412825) has the molecular formula C15H17NO4S2
and a molecular weight of 339.44 g/mol. Its IUPAC name is [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane.
Molecular Properties
| Compound Name | [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane |
| PubChem CID | 159412825 |
| Molecular Formula | C15H17NO4S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H](C(N)=O)c2ccccc2)cc1.S |
| InChI | InChI=1S/C15H15NO4S.H2S/c1-11-7-9-13(10-8-11)21(18,19)20-14(15(16)17)12-5-3-2-4-6-12;/h2-10,14H,1H3,(H2,16,17);1H2/t14-;/m0./s1 |
| InChIKey | LOUGMVPTDWQBAF-UQKRIMTDSA-N |
| XLogP | 2.04 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane?
The IUPAC name of [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane (CID 159412825) is [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane.
What is the SMILES notation for [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane?
The canonical SMILES for [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane is Cc1ccc(S(=O)(=O)O[C@H](C(N)=O)c2ccccc2)cc1.S.
What is the InChIKey of [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane?
The InChIKey is LOUGMVPTDWQBAF-UQKRIMTDSA-N. The full InChI is InChI=1S/C15H15NO4S.H2S/c1-11-7-9-13(10-8-11)21(18,19)20-14(15(16)17)12-5-3-2-4-6-12;/h2-10,14H,1H3,(H2,16,17);1H2/t14-;/m0./s1.
What are the key properties of [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane?
[(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane has a molecular weight of 339.44 g/mol, XLogP of 2.04, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2-amino-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate;sulfane is sourced from PubChem (CID 159412825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).