C21H26O5S — CID 141263651
ethyl 3,3-dimethyl-2-(4-methylphenyl)sulfonyloxy-2-phenylbutanoate (PubChem CID 141263651) has the molecular formula C21H26O5S and a molecular weight of 390.50 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-(4-methylphenyl)sulfonyloxy-2-phenylbutanoate.
| Compound Name | ethyl 3,3-dimethyl-2-(4-methylphenyl)sulfonyloxy-2-phenylbutanoate |
|---|---|
| PubChem CID | 141263651 |
| Molecular Formula | C21H26O5S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | ethyl 3,3-dimethyl-2-(4-methylphenyl)sulfonyloxy-2-phenylbutanoate |
| SMILES | CCOC(=O)C(OS(=O)(=O)c1ccc(C)cc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H26O5S/c1-6-25-19(22)21(20(3,4)5,17-10-8-7-9-11-17)26-27(23,24)18-14-12-16(2)13-15-18/h7-15H,6H2,1-5H3 |
| InChIKey | QZBJAPYLHYWGCJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|