About 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate
2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate (PubChem CID 139700681) has the molecular formula C21H24O6S
and a molecular weight of 404.48 g/mol. Its IUPAC name is 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate.
Molecular Properties
| Compound Name | 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate |
| PubChem CID | 139700681 |
| Molecular Formula | C21H24O6S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate |
| SMILES | CC(=O)C(C)(OS(=O)(=O)c1ccc(C)cc1)C(=O)OC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H24O6S/c1-15-11-13-18(14-12-15)28(24,25)27-21(5,16(2)22)19(23)26-20(3,4)17-9-7-6-8-10-17/h6-14H,1-5H3 |
| InChIKey | MCBZCFCNUXKJAP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate?
The IUPAC name of 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate (CID 139700681) is 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate.
What is the SMILES notation for 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate?
The canonical SMILES for 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate is CC(=O)C(C)(OS(=O)(=O)c1ccc(C)cc1)C(=O)OC(C)(C)c1ccccc1.
What is the InChIKey of 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate?
The InChIKey is MCBZCFCNUXKJAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O6S/c1-15-11-13-18(14-12-15)28(24,25)27-21(5,16(2)22)19(23)26-20(3,4)17-9-7-6-8-10-17/h6-14H,1-5H3.
What are the key properties of 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate?
2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate has a molecular weight of 404.48 g/mol, XLogP of 3.53, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropan-2-yl 2-methyl-2-(4-methylphenyl)sulfonyloxy-3-oxobutanoate is sourced from PubChem (CID 139700681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).