C22H23O6PS — CID 87815465
[2-(4-methylphenyl)sulfonyloxy-1,3-diphenylpropan-2-yl]phosphonic acid (PubChem CID 87815465) has the molecular formula C22H23O6PS and a molecular weight of 446.46 g/mol. Its IUPAC name is [2-(4-methylphenyl)sulfonyloxy-1,3-diphenylpropan-2-yl]phosphonic acid.
| Compound Name | [2-(4-methylphenyl)sulfonyloxy-1,3-diphenylpropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 87815465 |
| Molecular Formula | C22H23O6PS |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | [2-(4-methylphenyl)sulfonyloxy-1,3-diphenylpropan-2-yl]phosphonic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC(Cc2ccccc2)(Cc2ccccc2)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C22H23O6PS/c1-18-12-14-21(15-13-18)30(26,27)28-22(29(23,24)25,16-19-8-4-2-5-9-19)17-20-10-6-3-7-11-20/h2-15H,16-17H2,1H3,(H2,23,24,25) |
| InChIKey | AAFXPZHMYKWJQL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|