C8H12NO5PS — CID 90024990
aminomethyl-(4-methylphenyl)sulfonyloxyphosphinic acid (PubChem CID 90024990) has the molecular formula C8H12NO5PS and a molecular weight of 265.23 g/mol. Its IUPAC name is aminomethyl-(4-methylphenyl)sulfonyloxyphosphinic acid.
| Compound Name | aminomethyl-(4-methylphenyl)sulfonyloxyphosphinic acid |
|---|---|
| PubChem CID | 90024990 |
| Molecular Formula | C8H12NO5PS |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | aminomethyl-(4-methylphenyl)sulfonyloxyphosphinic acid |
| SMILES | Cc1ccc(S(=O)(=O)OP(=O)(O)CN)cc1 |
| InChI | InChI=1S/C8H12NO5PS/c1-7-2-4-8(5-3-7)16(12,13)14-15(10,11)6-9/h2-5H,6,9H2,1H3,(H,10,11) |
| InChIKey | TVCMMZOGHVEMGM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|