C12H19O4PS — CID 156816853
diethylphosphorylmethyl 4-methylbenzenesulfonate (PubChem CID 156816853) has the molecular formula C12H19O4PS and a molecular weight of 290.32 g/mol. Its IUPAC name is diethylphosphorylmethyl 4-methylbenzenesulfonate.
| Compound Name | diethylphosphorylmethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 156816853 |
| Molecular Formula | C12H19O4PS |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | diethylphosphorylmethyl 4-methylbenzenesulfonate |
| SMILES | CCP(=O)(CC)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H19O4PS/c1-4-17(13,5-2)10-16-18(14,15)12-8-6-11(3)7-9-12/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | VJVHPYDPBBLDDY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|