C15H25O7PS — CID 154191655
[diethoxymethyl(ethoxy)phosphoryl]methyl 4-methylbenzenesulfonate (PubChem CID 154191655) has the molecular formula C15H25O7PS and a molecular weight of 380.40 g/mol. Its IUPAC name is [diethoxymethyl(ethoxy)phosphoryl]methyl 4-methylbenzenesulfonate.
| Compound Name | [diethoxymethyl(ethoxy)phosphoryl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154191655 |
| Molecular Formula | C15H25O7PS |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [diethoxymethyl(ethoxy)phosphoryl]methyl 4-methylbenzenesulfonate |
| SMILES | CCOC(OCC)P(=O)(COS(=O)(=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C15H25O7PS/c1-5-19-15(20-6-2)23(16,21-7-3)12-22-24(17,18)14-10-8-13(4)9-11-14/h8-11,15H,5-7,12H2,1-4H3 |
| InChIKey | VIRLJMNFQLVNQJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|