C16H27O8PS — CID 166556148
[4-(diethoxyphosphorylmethoxy)-2-hydroxybutyl] 4-methylbenzenesulfonate (PubChem CID 166556148) has the molecular formula C16H27O8PS and a molecular weight of 410.43 g/mol. Its IUPAC name is [4-(diethoxyphosphorylmethoxy)-2-hydroxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(diethoxyphosphorylmethoxy)-2-hydroxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 166556148 |
| Molecular Formula | C16H27O8PS |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [4-(diethoxyphosphorylmethoxy)-2-hydroxybutyl] 4-methylbenzenesulfonate |
| SMILES | CCOP(=O)(COCCC(O)COS(=O)(=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C16H27O8PS/c1-4-22-25(18,23-5-2)13-21-11-10-15(17)12-24-26(19,20)16-8-6-14(3)7-9-16/h6-9,15,17H,4-5,10-13H2,1-3H3 |
| InChIKey | SMVDDSGKQADWLI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|