C17H30NO4P — CID 14362835
3-[diethoxymethyl(ethoxy)phosphoryl]-2-(4-methylphenyl)propan-1-amine (PubChem CID 14362835) has the molecular formula C17H30NO4P and a molecular weight of 343.40 g/mol. Its IUPAC name is 3-[diethoxymethyl(ethoxy)phosphoryl]-2-(4-methylphenyl)propan-1-amine.
| Compound Name | 3-[diethoxymethyl(ethoxy)phosphoryl]-2-(4-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 14362835 |
| Molecular Formula | C17H30NO4P |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 3-[diethoxymethyl(ethoxy)phosphoryl]-2-(4-methylphenyl)propan-1-amine |
| SMILES | CCOC(OCC)P(=O)(CC(CN)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C17H30NO4P/c1-5-20-17(21-6-2)23(19,22-7-3)13-16(12-18)15-10-8-14(4)9-11-15/h8-11,16-17H,5-7,12-13,18H2,1-4H3 |
| InChIKey | FDWBJRUGLLJFRI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|