C30H40NO5P — CID 10007060
(3R)-1-[diethoxymethyl(ethoxy)phosphoryl]-3-(tritylamino)butan-2-ol (PubChem CID 10007060) has the molecular formula C30H40NO5P and a molecular weight of 525.63 g/mol. Its IUPAC name is (3R)-1-[diethoxymethyl(ethoxy)phosphoryl]-3-(tritylamino)butan-2-ol.
| Compound Name | (3R)-1-[diethoxymethyl(ethoxy)phosphoryl]-3-(tritylamino)butan-2-ol |
|---|---|
| PubChem CID | 10007060 |
| Molecular Formula | C30H40NO5P |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | (3R)-1-[diethoxymethyl(ethoxy)phosphoryl]-3-(tritylamino)butan-2-ol |
| SMILES | CCOC(OCC)P(=O)(CC(O)[C@@H](C)NC(c1ccccc1)(c1ccccc1)c1ccccc1)OCC |
| InChI | InChI=1S/C30H40NO5P/c1-5-34-29(35-6-2)37(33,36-7-3)23-28(32)24(4)31-30(25-17-11-8-12-18-25,26-19-13-9-14-20-26)27-21-15-10-16-22-27/h8-22,24,28-29,31-32H,5-7,23H2,1-4H3/t24-,28?,37?/m1/s1 |
| InChIKey | KHZSKGRYLLICSN-LREPZWTESA-N |
| XLogP | 5.99 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|