C29H33N2O3P — CID 101389166
[butyl(ethoxy)phosphoryl]-(1-tritylimidazol-4-yl)methanol (PubChem CID 101389166) has the molecular formula C29H33N2O3P and a molecular weight of 488.57 g/mol. Its IUPAC name is [butyl(ethoxy)phosphoryl]-(1-tritylimidazol-4-yl)methanol.
| Compound Name | [butyl(ethoxy)phosphoryl]-(1-tritylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 101389166 |
| Molecular Formula | C29H33N2O3P |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | [butyl(ethoxy)phosphoryl]-(1-tritylimidazol-4-yl)methanol |
| SMILES | CCCCP(=O)(OCC)C(O)c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C29H33N2O3P/c1-3-5-21-35(33,34-4-2)28(32)27-22-31(23-30-27)29(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,22-23,28,32H,3-5,21H2,1-2H3 |
| InChIKey | WWDNOLHKEYNMPB-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|