C39H35N3O4 — CID 141215606
ethyl 2-hydroxy-3-[6-(methylcarbamoyl)naphthalen-2-yl]-3-(1-tritylimidazol-4-yl)propanoate (PubChem CID 141215606) has the molecular formula C39H35N3O4 and a molecular weight of 609.73 g/mol. Its IUPAC name is ethyl 2-hydroxy-3-[6-(methylcarbamoyl)naphthalen-2-yl]-3-(1-tritylimidazol-4-yl)propanoate.
| Compound Name | ethyl 2-hydroxy-3-[6-(methylcarbamoyl)naphthalen-2-yl]-3-(1-tritylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 141215606 |
| Molecular Formula | C39H35N3O4 |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | ethyl 2-hydroxy-3-[6-(methylcarbamoyl)naphthalen-2-yl]-3-(1-tritylimidazol-4-yl)propanoate |
| SMILES | CCOC(=O)C(O)C(c1ccc2cc(C(=O)NC)ccc2c1)c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C39H35N3O4/c1-3-46-38(45)36(43)35(29-21-19-28-24-30(37(44)40-2)22-20-27(28)23-29)34-25-42(26-41-34)39(31-13-7-4-8-14-31,32-15-9-5-10-16-32)33-17-11-6-12-18-33/h4-26,35-36,43H,3H2,1-2H3,(H,40,44) |
| InChIKey | DCUFNWRYTRLAAE-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|