C41H39N3O4 — CID 66650554
2-[(S)-hydroxy-[6-(methylcarbamoyl)naphthalen-2-yl]-(1-tritylimidazol-4-yl)methyl]-3,3-dimethylbutanoic acid (PubChem CID 66650554) has the molecular formula C41H39N3O4 and a molecular weight of 637.78 g/mol. Its IUPAC name is 2-[(S)-hydroxy-[6-(methylcarbamoyl)naphthalen-2-yl]-(1-tritylimidazol-4-yl)methyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(S)-hydroxy-[6-(methylcarbamoyl)naphthalen-2-yl]-(1-tritylimidazol-4-yl)methyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 66650554 |
| Molecular Formula | C41H39N3O4 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | 2-[(S)-hydroxy-[6-(methylcarbamoyl)naphthalen-2-yl]-(1-tritylimidazol-4-yl)methyl]-3,3-dimethylbutanoic acid |
| SMILES | CNC(=O)c1ccc2cc([C@](O)(c3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cn3)C(C(=O)O)C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C41H39N3O4/c1-39(2,3)36(38(46)47)41(48,34-23-22-28-24-30(37(45)42-4)21-20-29(28)25-34)35-26-44(27-43-35)40(31-14-8-5-9-15-31,32-16-10-6-11-17-32)33-18-12-7-13-19-33/h5-27,36,48H,1-4H3,(H,42,45)(H,46,47)/t36?,41-/m0/s1 |
| InChIKey | XVQXWXDNTXATPU-UNNQYVMBSA-N |
| XLogP | 7.22 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|