C38H33ClN2O3 — CID 18769130
methyl 1-chloro-6-[1-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]naphthalene-2-carboxylate (PubChem CID 18769130) has the molecular formula C38H33ClN2O3 and a molecular weight of 601.15 g/mol. Its IUPAC name is methyl 1-chloro-6-[1-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]naphthalene-2-carboxylate.
| Compound Name | methyl 1-chloro-6-[1-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 18769130 |
| Molecular Formula | C38H33ClN2O3 |
| Molecular Weight | 601.15 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | methyl 1-chloro-6-[1-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]naphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2cc(C(O)(c3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cn3)C(C)C)ccc2c1Cl |
| InChI | InChI=1S/C38H33ClN2O3/c1-26(2)38(43,31-20-22-32-27(23-31)19-21-33(35(32)39)36(42)44-3)34-24-41(25-40-34)37(28-13-7-4-8-14-28,29-15-9-5-10-16-29)30-17-11-6-12-18-30/h4-26,43H,1-3H3 |
| InChIKey | VIFZPSQIDQJXGM-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.15 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|