C38H35N3O2S — CID 18668576
5-[4-[1-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]phenyl]-N-methylthiophene-2-carboxamide (PubChem CID 18668576) has the molecular formula C38H35N3O2S and a molecular weight of 597.78 g/mol. Its IUPAC name is 5-[4-[1-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]phenyl]-N-methylthiophene-2-carboxamide.
| Compound Name | 5-[4-[1-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]phenyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 18668576 |
| Molecular Formula | C38H35N3O2S |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | 5-[4-[1-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]phenyl]-N-methylthiophene-2-carboxamide |
| SMILES | CNC(=O)c1ccc(-c2ccc(C(O)(c3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cn3)C(C)C)cc2)s1 |
| InChI | InChI=1S/C38H35N3O2S/c1-27(2)38(43,32-21-19-28(20-22-32)33-23-24-34(44-33)36(42)39-3)35-25-41(26-40-35)37(29-13-7-4-8-14-29,30-15-9-5-10-16-30)31-17-11-6-12-18-31/h4-27,43H,1-3H3,(H,39,42) |
| InChIKey | AJAGXCRREPCQFL-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|