C38H33N3O4 — CID 66650487
(3S)-3-hydroxy-2-methyl-3-[6-(methylcarbamoyl)naphthalen-2-yl]-3-(1-tritylimidazol-4-yl)propanoic acid (PubChem CID 66650487) has the molecular formula C38H33N3O4 and a molecular weight of 595.70 g/mol. Its IUPAC name is (3S)-3-hydroxy-2-methyl-3-[6-(methylcarbamoyl)naphthalen-2-yl]-3-(1-tritylimidazol-4-yl)propanoic acid.
| Compound Name | (3S)-3-hydroxy-2-methyl-3-[6-(methylcarbamoyl)naphthalen-2-yl]-3-(1-tritylimidazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 66650487 |
| Molecular Formula | C38H33N3O4 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | (3S)-3-hydroxy-2-methyl-3-[6-(methylcarbamoyl)naphthalen-2-yl]-3-(1-tritylimidazol-4-yl)propanoic acid |
| SMILES | CNC(=O)c1ccc2cc([C@](O)(c3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cn3)C(C)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C38H33N3O4/c1-26(36(43)44)38(45,33-21-20-27-22-29(35(42)39-2)19-18-28(27)23-33)34-24-41(25-40-34)37(30-12-6-3-7-13-30,31-14-8-4-9-15-31)32-16-10-5-11-17-32/h3-26,45H,1-2H3,(H,39,42)(H,43,44)/t26?,38-/m0/s1 |
| InChIKey | DUMYJUHEBZOPFN-OKPNAEFXSA-N |
| XLogP | 6.19 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|