C39H38N2O3 — CID 54088169
1-[6-(2-methoxyethoxy)naphthalen-2-yl]-2-methyl-1-(1-tritylimidazol-4-yl)propan-1-ol (PubChem CID 54088169) has the molecular formula C39H38N2O3 and a molecular weight of 582.74 g/mol. Its IUPAC name is 1-[6-(2-methoxyethoxy)naphthalen-2-yl]-2-methyl-1-(1-tritylimidazol-4-yl)propan-1-ol.
| Compound Name | 1-[6-(2-methoxyethoxy)naphthalen-2-yl]-2-methyl-1-(1-tritylimidazol-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 54088169 |
| Molecular Formula | C39H38N2O3 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | 1-[6-(2-methoxyethoxy)naphthalen-2-yl]-2-methyl-1-(1-tritylimidazol-4-yl)propan-1-ol |
| SMILES | COCCOc1ccc2cc(C(O)(c3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cn3)C(C)C)ccc2c1 |
| InChI | InChI=1S/C39H38N2O3/c1-29(2)39(42,35-21-19-31-26-36(44-24-23-43-3)22-20-30(31)25-35)37-27-41(28-40-37)38(32-13-7-4-8-14-32,33-15-9-5-10-16-33)34-17-11-6-12-18-34/h4-22,25-29,42H,23-24H2,1-3H3 |
| InChIKey | MRYMTNIWHPCSNN-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|