C39H37N3O3 — CID 87632573
N-ethoxy-6-[3-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]naphthalene-2-carboxamide (PubChem CID 87632573) has the molecular formula C39H37N3O3 and a molecular weight of 595.74 g/mol. Its IUPAC name is N-ethoxy-6-[3-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]naphthalene-2-carboxamide.
| Compound Name | N-ethoxy-6-[3-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 87632573 |
| Molecular Formula | C39H37N3O3 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | N-ethoxy-6-[3-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]naphthalene-2-carboxamide |
| SMILES | CCONC(=O)c1ccc2cc(C(c3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cn3)C(C)CO)ccc2c1 |
| InChI | InChI=1S/C39H37N3O3/c1-3-45-41-38(44)32-22-20-29-23-31(21-19-30(29)24-32)37(28(2)26-43)36-25-42(27-40-36)39(33-13-7-4-8-14-33,34-15-9-5-10-16-34)35-17-11-6-12-18-35/h4-25,27-28,37,43H,3,26H2,1-2H3,(H,41,44) |
| InChIKey | QACSAFPTLBRFPD-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|