C34H39N3O3 — CID 46929445
tert-butyl 4-[2-hydroxy-1-(1-tritylimidazol-4-yl)ethyl]piperidine-1-carboxylate (PubChem CID 46929445) has the molecular formula C34H39N3O3 and a molecular weight of 537.70 g/mol. Its IUPAC name is tert-butyl 4-[2-hydroxy-1-(1-tritylimidazol-4-yl)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-hydroxy-1-(1-tritylimidazol-4-yl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46929445 |
| Molecular Formula | C34H39N3O3 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | tert-butyl 4-[2-hydroxy-1-(1-tritylimidazol-4-yl)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(CO)c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C34H39N3O3/c1-33(2,3)40-32(39)36-21-19-26(20-22-36)30(24-38)31-23-37(25-35-31)34(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-18,23,25-26,30,38H,19-22,24H2,1-3H3 |
| InChIKey | SDEGANKWYATTBJ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|