C35H39N3O2 — CID 66853156
tert-butyl 4-[(Z)-2-(5-methyl-1-tritylimidazol-4-yl)ethenyl]piperidine-1-carboxylate (PubChem CID 66853156) has the molecular formula C35H39N3O2 and a molecular weight of 533.72 g/mol. Its IUPAC name is tert-butyl 4-[(Z)-2-(5-methyl-1-tritylimidazol-4-yl)ethenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(Z)-2-(5-methyl-1-tritylimidazol-4-yl)ethenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66853156 |
| Molecular Formula | C35H39N3O2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | tert-butyl 4-[(Z)-2-(5-methyl-1-tritylimidazol-4-yl)ethenyl]piperidine-1-carboxylate |
| SMILES | Cc1c(/C=C\C2CCN(C(=O)OC(C)(C)C)CC2)ncn1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H39N3O2/c1-27-32(21-20-28-22-24-37(25-23-28)33(39)40-34(2,3)4)36-26-38(27)35(29-14-8-5-9-15-29,30-16-10-6-11-17-30)31-18-12-7-13-19-31/h5-21,26,28H,22-25H2,1-4H3/b21-20- |
| InChIKey | AWKISPNZUBKQBV-MRCUWXFGSA-N |
| XLogP | 7.69 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|