C44H51N3O2S — CID 46929863
tert-butyl 4-[2-(4-tert-butylphenyl)sulfanyl-1-(1-tritylimidazol-4-yl)ethyl]piperidine-1-carboxylate (PubChem CID 46929863) has the molecular formula C44H51N3O2S and a molecular weight of 685.98 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-tert-butylphenyl)sulfanyl-1-(1-tritylimidazol-4-yl)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-tert-butylphenyl)sulfanyl-1-(1-tritylimidazol-4-yl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46929863 |
| Molecular Formula | C44H51N3O2S |
| Molecular Weight | 685.98 g/mol |
| Exact Mass | 685.37 |
| IUPAC Name | tert-butyl 4-[2-(4-tert-butylphenyl)sulfanyl-1-(1-tritylimidazol-4-yl)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(CSc2ccc(C(C)(C)C)cc2)c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C44H51N3O2S/c1-42(2,3)34-22-24-38(25-23-34)50-31-39(33-26-28-46(29-27-33)41(48)49-43(4,5)6)40-30-47(32-45-40)44(35-16-10-7-11-17-35,36-18-12-8-13-19-36)37-20-14-9-15-21-37/h7-25,30,32-33,39H,26-29,31H2,1-6H3 |
| InChIKey | NJPHWHMRUYNBPX-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.98 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|