C13H17NO5 — CID 171866592
ethyl 2,3-dihydroxy-3-[4-(methylcarbamoyl)phenyl]propanoate (PubChem CID 171866592) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-[4-(methylcarbamoyl)phenyl]propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-[4-(methylcarbamoyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171866592 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-[4-(methylcarbamoyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccc(C(=O)NC)cc1 |
| InChI | InChI=1S/C13H17NO5/c1-3-19-13(18)11(16)10(15)8-4-6-9(7-5-8)12(17)14-2/h4-7,10-11,15-16H,3H2,1-2H3,(H,14,17) |
| InChIKey | BQPNBPSZYKWLNO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |