C14H16O7 — CID 171865006
methyl 3-[4-(2-ethoxy-2-oxoacetyl)phenyl]-2,3-dihydroxypropanoate (PubChem CID 171865006) has the molecular formula C14H16O7 and a molecular weight of 296.28 g/mol. Its IUPAC name is methyl 3-[4-(2-ethoxy-2-oxoacetyl)phenyl]-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-[4-(2-ethoxy-2-oxoacetyl)phenyl]-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171865006 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | methyl 3-[4-(2-ethoxy-2-oxoacetyl)phenyl]-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(=O)c1ccc(C(O)C(O)C(=O)OC)cc1 |
| InChI | InChI=1S/C14H16O7/c1-3-21-14(19)11(16)9-6-4-8(5-7-9)10(15)12(17)13(18)20-2/h4-7,10,12,15,17H,3H2,1-2H3 |
| InChIKey | READRTJSTWBFJA-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|