C34H49NOSn — CID 134884047
(1R,2R)-1-tributylstannyl-2-(tritylamino)propan-1-ol (PubChem CID 134884047) has the molecular formula C34H49NOSn and a molecular weight of 606.48 g/mol. Its IUPAC name is (1R,2R)-1-tributylstannyl-2-(tritylamino)propan-1-ol.
| Compound Name | (1R,2R)-1-tributylstannyl-2-(tritylamino)propan-1-ol |
|---|---|
| PubChem CID | 134884047 |
| Molecular Formula | C34H49NOSn |
| Molecular Weight | 606.48 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | (1R,2R)-1-tributylstannyl-2-(tritylamino)propan-1-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@H](O)[C@@H](C)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22NO.3C4H9.Sn/c1-18(17-24)23-22(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;3*1-3-4-2;/h2-18,23-24H,1H3;3*1,3-4H2,2H3;/t18-;;;;/m1..../s1 |
| InChIKey | UORHFVIRHCRXJV-HHVPYRKWSA-N |
| XLogP | 8.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.48 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|