C17H27O8PS — CID 102120992
[(4R,5R)-5-diethoxyphosphoryl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 102120992) has the molecular formula C17H27O8PS and a molecular weight of 422.44 g/mol. Its IUPAC name is [(4R,5R)-5-diethoxyphosphoryl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4R,5R)-5-diethoxyphosphoryl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102120992 |
| Molecular Formula | C17H27O8PS |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | [(4R,5R)-5-diethoxyphosphoryl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CCOP(=O)(OCC)[C@H]1OC(C)(C)O[C@@H]1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H27O8PS/c1-6-21-26(18,22-7-2)16-15(24-17(4,5)25-16)12-23-27(19,20)14-10-8-13(3)9-11-14/h8-11,15-16H,6-7,12H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | ULRZFQWFNCZBDP-HZPDHXFCSA-N |
| XLogP | 3.44 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|