C20H28O7S — CID 11144094
ethyl (Z)-5-[(4S,5R)-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxolan-4-yl]pent-4-enoate (PubChem CID 11144094) has the molecular formula C20H28O7S and a molecular weight of 412.50 g/mol. Its IUPAC name is ethyl (Z)-5-[(4S,5R)-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxolan-4-yl]pent-4-enoate.
| Compound Name | ethyl (Z)-5-[(4S,5R)-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxolan-4-yl]pent-4-enoate |
|---|---|
| PubChem CID | 11144094 |
| Molecular Formula | C20H28O7S |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | ethyl (Z)-5-[(4S,5R)-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxolan-4-yl]pent-4-enoate |
| SMILES | CCOC(=O)CC/C=C\[C@@H]1OC(C)(C)O[C@@H]1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H28O7S/c1-5-24-19(21)9-7-6-8-17-18(27-20(3,4)26-17)14-25-28(22,23)16-12-10-15(2)11-13-16/h6,8,10-13,17-18H,5,7,9,14H2,1-4H3/b8-6-/t17-,18+/m0/s1 |
| InChIKey | LHLJLPCBESFOCR-PZFPIALWSA-N |
| XLogP | 3.12 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|