C22H24NO7PS4 — CID 122414667
[(4-methylphenyl)sulfonyloxymethyl-[(pyridin-2-yldisulfanyl)methyl]phosphoryl]methyl 4-methylbenzenesulfonate (PubChem CID 122414667) has the molecular formula C22H24NO7PS4 and a molecular weight of 573.68 g/mol. Its IUPAC name is [(4-methylphenyl)sulfonyloxymethyl-[(pyridin-2-yldisulfanyl)methyl]phosphoryl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4-methylphenyl)sulfonyloxymethyl-[(pyridin-2-yldisulfanyl)methyl]phosphoryl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 122414667 |
| Molecular Formula | C22H24NO7PS4 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.02 |
| IUPAC Name | [(4-methylphenyl)sulfonyloxymethyl-[(pyridin-2-yldisulfanyl)methyl]phosphoryl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCP(=O)(COS(=O)(=O)c2ccc(C)cc2)CSSc2ccccn2)cc1 |
| InChI | InChI=1S/C22H24NO7PS4/c1-18-6-10-20(11-7-18)34(25,26)29-15-31(24,17-32-33-22-5-3-4-14-23-22)16-30-35(27,28)21-12-8-19(2)9-13-21/h3-14H,15-17H2,1-2H3 |
| InChIKey | AXVQGBPYYNCQSM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 116.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|