C15H14F3IO3S — CID 134929766
[octa-1,3-diynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 134929766) has the molecular formula C15H14F3IO3S and a molecular weight of 458.24 g/mol. Its IUPAC name is [octa-1,3-diynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [octa-1,3-diynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134929766 |
| Molecular Formula | C15H14F3IO3S |
| Molecular Weight | 458.24 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | [octa-1,3-diynyl(phenyl)-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | CCCCC#CC#CI(OS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H14F3IO3S/c1-2-3-4-5-6-10-13-19(14-11-8-7-9-12-14)22-23(20,21)15(16,17)18/h7-9,11-12H,2-4H2,1H3 |
| InChIKey | XOSCOYAKHOBREP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.24 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|