C13H8F13IO3S — CID 139878221
[phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-λ3-iodanyl] methanesulfonate (PubChem CID 139878221) has the molecular formula C13H8F13IO3S and a molecular weight of 618.15 g/mol. Its IUPAC name is [phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-λ3-iodanyl] methanesulfonate.
| Compound Name | [phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-λ3-iodanyl] methanesulfonate |
|---|---|
| PubChem CID | 139878221 |
| Molecular Formula | C13H8F13IO3S |
| Molecular Weight | 618.15 g/mol |
| Exact Mass | 617.90 |
| IUPAC Name | [phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-λ3-iodanyl] methanesulfonate |
| SMILES | CS(=O)(=O)OI(c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8F13IO3S/c1-31(28,29)30-27(7-5-3-2-4-6-7)13(25,26)11(20,21)9(16,17)8(14,15)10(18,19)12(22,23)24/h2-6H,1H3 |
| InChIKey | KHZWQBJRZBCJRE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.15 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|