C10H4F11IO3S — CID 12951089
[(4-fluorophenyl)-(1,1,2,2,3,3,3-heptafluoropropyl)-lambda3-iodanyl] trifluoromethanesulfonate (PubChem CID 12951089) has the molecular formula C10H4F11IO3S and a molecular weight of 540.09 g/mol. Its IUPAC name is [(4-fluorophenyl)-(1,1,2,2,3,3,3-heptafluoropropyl)-lambda3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [(4-fluorophenyl)-(1,1,2,2,3,3,3-heptafluoropropyl)-lambda3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 12951089 |
| Molecular Formula | C10H4F11IO3S |
| Molecular Weight | 540.09 g/mol |
| Exact Mass | 539.88 |
| IUPAC Name | [(4-fluorophenyl)-(1,1,2,2,3,3,3-heptafluoropropyl)-lambda3-iodanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OI(c1ccc(F)cc1)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H4F11IO3S/c11-5-1-3-6(4-2-5)22(25-26(23,24)10(19,20)21)9(17,18)7(12,13)8(14,15)16/h1-4H |
| InChIKey | YRPKWLOMLWSMJB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.09 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|