C11H8Cl2O3S — CID 11162108
(1,1-dichloro-4-phenylbut-1-en-3-yn-2-yl) methanesulfonate (PubChem CID 11162108) has the molecular formula C11H8Cl2O3S and a molecular weight of 291.16 g/mol. Its IUPAC name is (1,1-dichloro-4-phenylbut-1-en-3-yn-2-yl) methanesulfonate.
| Compound Name | (1,1-dichloro-4-phenylbut-1-en-3-yn-2-yl) methanesulfonate |
|---|---|
| PubChem CID | 11162108 |
| Molecular Formula | C11H8Cl2O3S |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 289.96 |
| IUPAC Name | (1,1-dichloro-4-phenylbut-1-en-3-yn-2-yl) methanesulfonate |
| SMILES | CS(=O)(=O)OC(C#Cc1ccccc1)=C(Cl)Cl |
| InChI | InChI=1S/C11H8Cl2O3S/c1-17(14,15)16-10(11(12)13)8-7-9-5-3-2-4-6-9/h2-6H,1H3 |
| InChIKey | BTAGCPGHJKKWAR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|