About (diethyl-λ3-iodanyl) trifluoromethanesulfonate
(diethyl-λ3-iodanyl) trifluoromethanesulfonate (PubChem CID 168791229) has the molecular formula C5H10F3IO3S
and a molecular weight of 334.10 g/mol. Its IUPAC name is (diethyl-λ3-iodanyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (diethyl-λ3-iodanyl) trifluoromethanesulfonate |
| PubChem CID | 168791229 |
| Molecular Formula | C5H10F3IO3S |
| Molecular Weight | 334.10 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | (diethyl-λ3-iodanyl) trifluoromethanesulfonate |
| SMILES | CCI(CC)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H10F3IO3S/c1-3-9(4-2)12-13(10,11)5(6,7)8/h3-4H2,1-2H3 |
| InChIKey | ULHIGTUGQDRMCJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.10 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (diethyl-λ3-iodanyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (diethyl-λ3-iodanyl) trifluoromethanesulfonate?
The IUPAC name of (diethyl-λ3-iodanyl) trifluoromethanesulfonate (CID 168791229) is (diethyl-λ3-iodanyl) trifluoromethanesulfonate.
What is the SMILES notation for (diethyl-λ3-iodanyl) trifluoromethanesulfonate?
The canonical SMILES for (diethyl-λ3-iodanyl) trifluoromethanesulfonate is CCI(CC)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of (diethyl-λ3-iodanyl) trifluoromethanesulfonate?
The InChIKey is ULHIGTUGQDRMCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F3IO3S/c1-3-9(4-2)12-13(10,11)5(6,7)8/h3-4H2,1-2H3.
What are the key properties of (diethyl-λ3-iodanyl) trifluoromethanesulfonate?
(diethyl-λ3-iodanyl) trifluoromethanesulfonate has a molecular weight of 334.10 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (diethyl-λ3-iodanyl) trifluoromethanesulfonate is sourced from PubChem (CID 168791229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).