About 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate
1-(oxolan-3-yl)ethyl trifluoromethanesulfonate (PubChem CID 102621715) has the molecular formula C7H11F3O4S
and a molecular weight of 248.22 g/mol. Its IUPAC name is 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate |
| PubChem CID | 102621715 |
| Molecular Formula | C7H11F3O4S |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate |
| SMILES | CC(OS(=O)(=O)C(F)(F)F)C1CCOC1 |
| InChI | InChI=1S/C7H11F3O4S/c1-5(6-2-3-13-4-6)14-15(11,12)7(8,9)10/h5-6H,2-4H2,1H3 |
| InChIKey | FPMYPPCZJSPGOF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate?
The IUPAC name of 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate (CID 102621715) is 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate.
What is the SMILES notation for 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate?
The canonical SMILES for 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate is CC(OS(=O)(=O)C(F)(F)F)C1CCOC1.
What is the InChIKey of 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate?
The InChIKey is FPMYPPCZJSPGOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3O4S/c1-5(6-2-3-13-4-6)14-15(11,12)7(8,9)10/h5-6H,2-4H2,1H3.
What are the key properties of 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate?
1-(oxolan-3-yl)ethyl trifluoromethanesulfonate has a molecular weight of 248.22 g/mol, XLogP of 1.28, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-yl)ethyl trifluoromethanesulfonate is sourced from PubChem (CID 102621715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).