About 3-(1-ethoxyethyl)oxolane
3-(1-ethoxyethyl)oxolane (PubChem CID 11788363) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 3-(1-ethoxyethyl)oxolane.
Molecular Properties
| Compound Name | 3-(1-ethoxyethyl)oxolane |
| PubChem CID | 11788363 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 3-(1-ethoxyethyl)oxolane |
| SMILES | CCOC(C)C1CCOC1 |
| InChI | InChI=1S/C8H16O2/c1-3-10-7(2)8-4-5-9-6-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | OACIZJGJEQLUTH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1-ethoxyethyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethoxyethyl)oxolane?
The IUPAC name of 3-(1-ethoxyethyl)oxolane (CID 11788363) is 3-(1-ethoxyethyl)oxolane.
What is the SMILES notation for 3-(1-ethoxyethyl)oxolane?
The canonical SMILES for 3-(1-ethoxyethyl)oxolane is CCOC(C)C1CCOC1.
What is the InChIKey of 3-(1-ethoxyethyl)oxolane?
The InChIKey is OACIZJGJEQLUTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-3-10-7(2)8-4-5-9-6-8/h7-8H,3-6H2,1-2H3.
What are the key properties of 3-(1-ethoxyethyl)oxolane?
3-(1-ethoxyethyl)oxolane has a molecular weight of 144.21 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethoxyethyl)oxolane is sourced from PubChem (CID 11788363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).