C10H4BrF9O3S — CID 11385514
(4-bromophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 11385514) has the molecular formula C10H4BrF9O3S and a molecular weight of 455.09 g/mol. Its IUPAC name is (4-bromophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (4-bromophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 11385514 |
| Molecular Formula | C10H4BrF9O3S |
| Molecular Weight | 455.09 g/mol |
| Exact Mass | 453.89 |
| IUPAC Name | (4-bromophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(Oc1ccc(Br)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H4BrF9O3S/c11-5-1-3-6(4-2-5)23-24(21,22)10(19,20)8(14,15)7(12,13)9(16,17)18/h1-4H |
| InChIKey | NWJIJYUZQPEFBU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.09 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|