C10H3Cl2F9O3S — CID 162537534
(3,5-dichlorophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 162537534) has the molecular formula C10H3Cl2F9O3S and a molecular weight of 445.09 g/mol. Its IUPAC name is (3,5-dichlorophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (3,5-dichlorophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 162537534 |
| Molecular Formula | C10H3Cl2F9O3S |
| Molecular Weight | 445.09 g/mol |
| Exact Mass | 443.90 |
| IUPAC Name | (3,5-dichlorophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(Oc1cc(Cl)cc(Cl)c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H3Cl2F9O3S/c11-4-1-5(12)3-6(2-4)24-25(22,23)10(20,21)8(15,16)7(13,14)9(17,18)19/h1-3H |
| InChIKey | ICHGUGBLIVTPQE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.09 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|