C14H7F9O3S2 — CID 118514326
(4-thiophen-2-ylphenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 118514326) has the molecular formula C14H7F9O3S2 and a molecular weight of 458.32 g/mol. Its IUPAC name is (4-thiophen-2-ylphenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (4-thiophen-2-ylphenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 118514326 |
| Molecular Formula | C14H7F9O3S2 |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | (4-thiophen-2-ylphenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2cccs2)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H7F9O3S2/c15-11(16,13(19,20)21)12(17,18)14(22,23)28(24,25)26-9-5-3-8(4-6-9)10-2-1-7-27-10/h1-7H |
| InChIKey | IRMCQRFJAZUMEZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|