C16H13F6IO3S — CID 175318605
1-tert-butyl-4-iodobenzene;fluoro 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 175318605) has the molecular formula C16H13F6IO3S and a molecular weight of 526.24 g/mol. Its IUPAC name is 1-tert-butyl-4-iodobenzene;fluoro 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | 1-tert-butyl-4-iodobenzene;fluoro 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 175318605 |
| Molecular Formula | C16H13F6IO3S |
| Molecular Weight | 526.24 g/mol |
| Exact Mass | 525.95 |
| IUPAC Name | 1-tert-butyl-4-iodobenzene;fluoro 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | CC(C)(C)c1ccc(I)cc1.O=S(=O)(OF)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H13I.C6F6O3S/c1-10(2,3)8-4-6-9(11)7-5-8;7-1-2(8)4(10)6(5(11)3(1)9)16(13,14)15-12/h4-7H,1-3H3; |
| InChIKey | WJUXGNUYMAEGDR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.24 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|