C18H28O4S — CID 14292099
oxiran-2-ylmethyl 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 14292099) has the molecular formula C18H28O4S and a molecular weight of 340.49 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | oxiran-2-ylmethyl 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 14292099 |
| Molecular Formula | C18H28O4S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | oxiran-2-ylmethyl 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)OCC2CO2)c(C(C)C)c1 |
| InChI | InChI=1S/C18H28O4S/c1-11(2)14-7-16(12(3)4)18(17(8-14)13(5)6)23(19,20)22-10-15-9-21-15/h7-8,11-13,15H,9-10H2,1-6H3 |
| InChIKey | JGWXTQTXMUWTCO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|