C34H57N3 — CID 18441023
N-[2-[2,4,6-tri(propan-2-yl)anilino]ethyl]-N'-[2,4,6-tri(propan-2-yl)phenyl]ethane-1,2-diamine (PubChem CID 18441023) has the molecular formula C34H57N3 and a molecular weight of 507.85 g/mol. Its IUPAC name is N-[2-[2,4,6-tri(propan-2-yl)anilino]ethyl]-N'-[2,4,6-tri(propan-2-yl)phenyl]ethane-1,2-diamine.
| Compound Name | N-[2-[2,4,6-tri(propan-2-yl)anilino]ethyl]-N'-[2,4,6-tri(propan-2-yl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 18441023 |
| Molecular Formula | C34H57N3 |
| Molecular Weight | 507.85 g/mol |
| Exact Mass | 507.46 |
| IUPAC Name | N-[2-[2,4,6-tri(propan-2-yl)anilino]ethyl]-N'-[2,4,6-tri(propan-2-yl)phenyl]ethane-1,2-diamine |
| SMILES | CC(C)c1cc(C(C)C)c(NCCNCCNc2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C34H57N3/c1-21(2)27-17-29(23(5)6)33(30(18-27)24(7)8)36-15-13-35-14-16-37-34-31(25(9)10)19-28(22(3)4)20-32(34)26(11)12/h17-26,35-37H,13-16H2,1-12H3 |
| InChIKey | TUJIANYIDHGVNA-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.85 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|