C19H30ClPS — CID 177418599
(Z)-chloromethylidene-sulfido-(2,4,6-tritert-butylphenyl)phosphanium (PubChem CID 177418599) has the molecular formula C19H30ClPS and a molecular weight of 356.94 g/mol. Its IUPAC name is (Z)-chloromethylidene-sulfido-(2,4,6-tritert-butylphenyl)phosphanium.
| Compound Name | (Z)-chloromethylidene-sulfido-(2,4,6-tritert-butylphenyl)phosphanium |
|---|---|
| PubChem CID | 177418599 |
| Molecular Formula | C19H30ClPS |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (Z)-chloromethylidene-sulfido-(2,4,6-tritert-butylphenyl)phosphanium |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/[P+]([S-])=C/Cl)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H30ClPS/c1-17(2,3)13-10-14(18(4,5)6)16(21(22)12-20)15(11-13)19(7,8)9/h10-12H,1-9H3 |
| InChIKey | VRXKCOSMDNCEHH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|