C18H29NOS — CID 4079261
oxo-sulfido-(2,4,6-tritert-butylphenyl)azanium (PubChem CID 4079261) has the molecular formula C18H29NOS and a molecular weight of 307.50 g/mol. Its IUPAC name is oxo-sulfido-(2,4,6-tritert-butylphenyl)azanium.
| Compound Name | oxo-sulfido-(2,4,6-tritert-butylphenyl)azanium |
|---|---|
| PubChem CID | 4079261 |
| Molecular Formula | C18H29NOS |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | oxo-sulfido-(2,4,6-tritert-butylphenyl)azanium |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c([N+](=O)[S-])c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H29NOS/c1-16(2,3)12-10-13(17(4,5)6)15(19(20)21)14(11-12)18(7,8)9/h10-11H,1-9H3 |
| InChIKey | NJYGNXSSLYFCOV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|