C44H59O3P — CID 140971376
2,2-bis[2-(2,4-ditert-butyl-6-methylphenyl)phenyl]ethyl dihydrogen phosphite (PubChem CID 140971376) has the molecular formula C44H59O3P and a molecular weight of 666.93 g/mol. Its IUPAC name is 2,2-bis[2-(2,4-ditert-butyl-6-methylphenyl)phenyl]ethyl dihydrogen phosphite.
| Compound Name | 2,2-bis[2-(2,4-ditert-butyl-6-methylphenyl)phenyl]ethyl dihydrogen phosphite |
|---|---|
| PubChem CID | 140971376 |
| Molecular Formula | C44H59O3P |
| Molecular Weight | 666.93 g/mol |
| Exact Mass | 666.42 |
| IUPAC Name | 2,2-bis[2-(2,4-ditert-butyl-6-methylphenyl)phenyl]ethyl dihydrogen phosphite |
| SMILES | Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1-c1ccccc1C(COP(O)O)c1ccccc1-c1c(C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C44H59O3P/c1-28-23-30(41(3,4)5)25-37(43(9,10)11)39(28)34-21-17-15-19-32(34)36(27-47-48(45)46)33-20-16-18-22-35(33)40-29(2)24-31(42(6,7)8)26-38(40)44(12,13)14/h15-26,36,45-46H,27H2,1-14H3 |
| InChIKey | MVZIVAAANXGTAB-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.93 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|