C20H26Cl2OTi — CID 174365708
3,5-ditert-butyl-2-phenylphenol;dichlorotitanium (PubChem CID 174365708) has the molecular formula C20H26Cl2OTi and a molecular weight of 401.20 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-phenylphenol;dichlorotitanium.
| Compound Name | 3,5-ditert-butyl-2-phenylphenol;dichlorotitanium |
|---|---|
| PubChem CID | 174365708 |
| Molecular Formula | C20H26Cl2OTi |
| Molecular Weight | 401.20 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 3,5-ditert-butyl-2-phenylphenol;dichlorotitanium |
| SMILES | CC(C)(C)c1cc(O)c(-c2ccccc2)c(C(C)(C)C)c1.Cl[Ti]Cl |
| InChI | InChI=1S/C20H26O.2ClH.Ti/c1-19(2,3)15-12-16(20(4,5)6)18(17(21)13-15)14-10-8-7-9-11-14;;;/h7-13,21H,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | DQYPOIWNDVZVMT-UHFFFAOYSA-L |
| XLogP | 7.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.20 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |