C25H28O2 — CID 15418880
1-(2,4-ditert-butyl-6-hydroxyphenyl)naphthalene-2-carbaldehyde (PubChem CID 15418880) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-(2,4-ditert-butyl-6-hydroxyphenyl)naphthalene-2-carbaldehyde.
| Compound Name | 1-(2,4-ditert-butyl-6-hydroxyphenyl)naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 15418880 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 1-(2,4-ditert-butyl-6-hydroxyphenyl)naphthalene-2-carbaldehyde |
| SMILES | CC(C)(C)c1cc(O)c(-c2c(C=O)ccc3ccccc23)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H28O2/c1-24(2,3)18-13-20(25(4,5)6)23(21(27)14-18)22-17(15-26)12-11-16-9-7-8-10-19(16)22/h7-15,27H,1-6H3 |
| InChIKey | OOECSLKAMXHRFF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|