C29H42O2 — CID 102018966
5-tert-butyl-2-hydroxy-3-(2,4,6-tritert-butylphenyl)benzaldehyde (PubChem CID 102018966) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is 5-tert-butyl-2-hydroxy-3-(2,4,6-tritert-butylphenyl)benzaldehyde.
| Compound Name | 5-tert-butyl-2-hydroxy-3-(2,4,6-tritert-butylphenyl)benzaldehyde |
|---|---|
| PubChem CID | 102018966 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | 5-tert-butyl-2-hydroxy-3-(2,4,6-tritert-butylphenyl)benzaldehyde |
| SMILES | CC(C)(C)c1cc(C=O)c(O)c(-c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c1 |
| InChI | InChI=1S/C29H42O2/c1-26(2,3)19-13-18(17-30)25(31)21(14-19)24-22(28(7,8)9)15-20(27(4,5)6)16-23(24)29(10,11)12/h13-17,31H,1-12H3 |
| InChIKey | YSLXMIPPDSKNHP-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|