C60H58O8 — CID 141450138
3-tert-butyl-2-hydroxy-5-[3,6,8-tris(3-tert-butyl-5-formyl-4-hydroxyphenyl)pyren-1-yl]benzaldehyde (PubChem CID 141450138) has the molecular formula C60H58O8 and a molecular weight of 907.12 g/mol. Its IUPAC name is 3-tert-butyl-2-hydroxy-5-[3,6,8-tris(3-tert-butyl-5-formyl-4-hydroxyphenyl)pyren-1-yl]benzaldehyde.
| Compound Name | 3-tert-butyl-2-hydroxy-5-[3,6,8-tris(3-tert-butyl-5-formyl-4-hydroxyphenyl)pyren-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 141450138 |
| Molecular Formula | C60H58O8 |
| Molecular Weight | 907.12 g/mol |
| Exact Mass | 906.41 |
| IUPAC Name | 3-tert-butyl-2-hydroxy-5-[3,6,8-tris(3-tert-butyl-5-formyl-4-hydroxyphenyl)pyren-1-yl]benzaldehyde |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cc(C=O)c(O)c(C(C)(C)C)c3)c3ccc4c(-c5cc(C=O)c(O)c(C(C)(C)C)c5)cc(-c5cc(C=O)c(O)c(C(C)(C)C)c5)c5ccc2c3c54)cc(C=O)c1O |
| InChI | InChI=1S/C60H58O8/c1-57(2,3)47-21-31(17-35(27-61)53(47)65)43-25-44(32-18-36(28-62)54(66)48(22-32)58(4,5)6)40-15-16-42-46(34-20-38(30-64)56(68)50(24-34)60(10,11)12)26-45(41-14-13-39(43)51(40)52(41)42)33-19-37(29-63)55(67)49(23-33)59(7,8)9/h13-30,65-68H,1-12H3 |
| InChIKey | IZHBSOFMWMLNTO-UHFFFAOYSA-N |
| XLogP | 14.51 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.12 |
| LogP ≤ 5 | 14.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|