C19H22O4 — CID 15501148
5-tert-butyl-3-(2,6-dimethoxyphenyl)-2-hydroxybenzaldehyde (PubChem CID 15501148) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 5-tert-butyl-3-(2,6-dimethoxyphenyl)-2-hydroxybenzaldehyde.
| Compound Name | 5-tert-butyl-3-(2,6-dimethoxyphenyl)-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 15501148 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 5-tert-butyl-3-(2,6-dimethoxyphenyl)-2-hydroxybenzaldehyde |
| SMILES | COc1cccc(OC)c1-c1cc(C(C)(C)C)cc(C=O)c1O |
| InChI | InChI=1S/C19H22O4/c1-19(2,3)13-9-12(11-20)18(21)14(10-13)17-15(22-4)7-6-8-16(17)23-5/h6-11,21H,1-5H3 |
| InChIKey | PGMZXUDTTOPCBX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|