About 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium
3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium (PubChem CID 174369626) has the molecular formula C17H20Cl2OTi
and a molecular weight of 359.12 g/mol. Its IUPAC name is 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium.
Molecular Properties
| Compound Name | 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium |
| PubChem CID | 174369626 |
| Molecular Formula | C17H20Cl2OTi |
| Molecular Weight | 359.12 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium |
| SMILES | Cc1cc(O)c(-c2ccccc2)c(C(C)(C)C)c1.Cl[Ti]Cl |
| InChI | InChI=1S/C17H20O.2ClH.Ti/c1-12-10-14(17(2,3)4)16(15(18)11-12)13-8-6-5-7-9-13;;;/h5-11,18H,1-4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | VEGGJUGKAKHXLF-UHFFFAOYSA-L |
| XLogP | 6.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.12 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium?
The IUPAC name of 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium (CID 174369626) is 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium.
What is the SMILES notation for 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium?
The canonical SMILES for 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium is Cc1cc(O)c(-c2ccccc2)c(C(C)(C)C)c1.Cl[Ti]Cl.
What is the InChIKey of 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium?
The InChIKey is VEGGJUGKAKHXLF-UHFFFAOYSA-L. The full InChI is InChI=1S/C17H20O.2ClH.Ti/c1-12-10-14(17(2,3)4)16(15(18)11-12)13-8-6-5-7-9-13;;;/h5-11,18H,1-4H3;2*1H;/q;;;+2/p-2.
What are the key properties of 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium?
3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium has a molecular weight of 359.12 g/mol, XLogP of 6.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-methyl-2-phenylphenol;dichlorotitanium is sourced from PubChem (CID 174369626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).