About 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol
3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol (PubChem CID 100981555) has the molecular formula C26H30N2O
and a molecular weight of 386.54 g/mol. Its IUPAC name is 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol.
Molecular Properties
| Compound Name | 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol |
| PubChem CID | 100981555 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol |
| SMILES | Cc1cc(O)c(C2N[C@H](c3ccccc3)[C@@H](c3ccccc3)N2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H30N2O/c1-17-15-20(26(2,3)4)22(21(29)16-17)25-27-23(18-11-7-5-8-12-18)24(28-25)19-13-9-6-10-14-19/h5-16,23-25,27-29H,1-4H3/t23-,24-/m1/s1 |
| InChIKey | OCACOHQYQKKOMA-DNQXCXABSA-N |
| XLogP | 5.67 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol?
The IUPAC name of 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol (CID 100981555) is 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol.
What is the SMILES notation for 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol?
The canonical SMILES for 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol is Cc1cc(O)c(C2N[C@H](c3ccccc3)[C@@H](c3ccccc3)N2)c(C(C)(C)C)c1.
What is the InChIKey of 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol?
The InChIKey is OCACOHQYQKKOMA-DNQXCXABSA-N. The full InChI is InChI=1S/C26H30N2O/c1-17-15-20(26(2,3)4)22(21(29)16-17)25-27-23(18-11-7-5-8-12-18)24(28-25)19-13-9-6-10-14-19/h5-16,23-25,27-29H,1-4H3/t23-,24-/m1/s1.
What are the key properties of 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol?
3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol has a molecular weight of 386.54 g/mol, XLogP of 5.67, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2-[(4R,5R)-4,5-diphenylimidazolidin-2-yl]-5-methylphenol is sourced from PubChem (CID 100981555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).